| 释义 |
meprobamate /məˈprōbəˌmāt / /ˌməprōˈbaˌmāt/nounA bitter-tasting addictive carbamate used, especially before the 1970s, as a mild tranquilizer.- Chemical formula: CH3CH2CH2C(CH2OCONH2)2CH3.
Tranquilizers and some muscle relaxants, such as benzodiazepines, barbiturates and meprobamate (brand names: Equanil, Miltown), should be avoided if at all possible....- Miscellaneous other modern drugs, such as glutethimide and meprobamate, are also used as sedatives, as are some very old ones, such as chloral hydrate.
- Physicians were treating anxious outpatients with meprobamate, or Miltown, a popular tranquilliser of the 1950s and 1960s.
Origin Mid 20th century: from me(thyl) + pro(pyl) + (car)bamate. |